C13H28N4O — CID 55219817
N'-hydroxy-2-methyl-2-(4-pentylpiperazin-1-yl)propanimidamide (PubChem CID 55219817) has the molecular formula C13H28N4O and a molecular weight of 256.39 g/mol. Its IUPAC name is N'-hydroxy-2-methyl-2-(4-pentylpiperazin-1-yl)propanimidamide.
| Compound Name | N'-hydroxy-2-methyl-2-(4-pentylpiperazin-1-yl)propanimidamide |
|---|---|
| PubChem CID | 55219817 |
| Molecular Formula | C13H28N4O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.23 |
| IUPAC Name | N'-hydroxy-2-methyl-2-(4-pentylpiperazin-1-yl)propanimidamide |
| SMILES | CCCCCN1CCN(C(C)(C)/C(N)=N/O)CC1 |
| InChI | InChI=1S/C13H28N4O/c1-4-5-6-7-16-8-10-17(11-9-16)13(2,3)12(14)15-18/h18H,4-11H2,1-3H3,(H2,14,15) |
| InChIKey | ZBBDMHQAGQXUMM-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|