C13H25N3O2S — CID 104866189
2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(thian-4-ylmethyl)butanamide (PubChem CID 104866189) has the molecular formula C13H25N3O2S and a molecular weight of 287.43 g/mol. Its IUPAC name is 2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(thian-4-ylmethyl)butanamide.
| Compound Name | 2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(thian-4-ylmethyl)butanamide |
|---|---|
| PubChem CID | 104866189 |
| Molecular Formula | C13H25N3O2S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 2-ethyl-2-(N'-hydroxycarbamimidoyl)-N-(thian-4-ylmethyl)butanamide |
| SMILES | CCC(CC)(C(=O)NCC1CCSCC1)C(N)=NO |
| InChI | InChI=1S/C13H25N3O2S/c1-3-13(4-2,11(14)16-18)12(17)15-9-10-5-7-19-8-6-10/h10,18H,3-9H2,1-2H3,(H2,14,16)(H,15,17) |
| InChIKey | DDZKNYUDNOIIOH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|