C11H21N3O2 — CID 76919874
3-amino-N-(cyclopentylmethyl)-3-hydroxyimino-2,2-dimethylpropanamide (PubChem CID 76919874) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is 3-amino-N-(cyclopentylmethyl)-3-hydroxyimino-2,2-dimethylpropanamide.
| Compound Name | 3-amino-N-(cyclopentylmethyl)-3-hydroxyimino-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 76919874 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | 3-amino-N-(cyclopentylmethyl)-3-hydroxyimino-2,2-dimethylpropanamide |
| SMILES | CC(C)(C(=O)NCC1CCCC1)C(N)=NO |
| InChI | InChI=1S/C11H21N3O2/c1-11(2,9(12)14-16)10(15)13-7-8-5-3-4-6-8/h8,16H,3-7H2,1-2H3,(H2,12,14)(H,13,15) |
| InChIKey | MZZIDNQZOBNPCQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|