C8H15N3O2 — CID 76920327
3-amino-N-cyclopropyl-3-hydroxyimino-2,2-dimethylpropanamide (PubChem CID 76920327) has the molecular formula C8H15N3O2 and a molecular weight of 185.23 g/mol. Its IUPAC name is 3-amino-N-cyclopropyl-3-hydroxyimino-2,2-dimethylpropanamide.
| Compound Name | 3-amino-N-cyclopropyl-3-hydroxyimino-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 76920327 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 3-amino-N-cyclopropyl-3-hydroxyimino-2,2-dimethylpropanamide |
| SMILES | CC(C)(C(=O)NC1CC1)C(N)=NO |
| InChI | InChI=1S/C8H15N3O2/c1-8(2,6(9)11-13)7(12)10-5-3-4-5/h5,13H,3-4H2,1-2H3,(H2,9,11)(H,10,12) |
| InChIKey | ZTNCKMQFICJTCE-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|