C8H15Cl2NS — CID 104866986
N-(2,3-dichloroprop-2-enyl)-3-methylsulfanylbutan-1-amine (PubChem CID 104866986) has the molecular formula C8H15Cl2NS and a molecular weight of 228.19 g/mol. Its IUPAC name is N-(2,3-dichloroprop-2-enyl)-3-methylsulfanylbutan-1-amine.
| Compound Name | N-(2,3-dichloroprop-2-enyl)-3-methylsulfanylbutan-1-amine |
|---|---|
| PubChem CID | 104866986 |
| Molecular Formula | C8H15Cl2NS |
| Molecular Weight | 228.19 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | N-(2,3-dichloroprop-2-enyl)-3-methylsulfanylbutan-1-amine |
| SMILES | CSC(C)CCNCC(Cl)=CCl |
| InChI | InChI=1S/C8H15Cl2NS/c1-7(12-2)3-4-11-6-8(10)5-9/h5,7,11H,3-4,6H2,1-2H3 |
| InChIKey | RDNVERXYYHOLOI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.19 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|