About 4-aminooxolan-3-ol
4-aminooxolan-3-ol (PubChem CID 10486809) has the molecular formula C4H9NO2
and a molecular weight of 103.12 g/mol. Its IUPAC name is 4-aminooxolan-3-ol.
Molecular Properties
| Compound Name | 4-aminooxolan-3-ol |
| PubChem CID | 10486809 |
| Molecular Formula | C4H9NO2 |
| Molecular Weight | 103.12 g/mol |
| Exact Mass | 103.06 |
| IUPAC Name | 4-aminooxolan-3-ol |
| SMILES | NC1COCC1O |
| InChI | InChI=1S/C4H9NO2/c5-3-1-7-2-4(3)6/h3-4,6H,1-2,5H2 |
| InChIKey | HQVKXDYSIGDGSY-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.12 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-aminooxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminooxolan-3-ol?
The IUPAC name of 4-aminooxolan-3-ol (CID 10486809) is 4-aminooxolan-3-ol.
What is the SMILES notation for 4-aminooxolan-3-ol?
The canonical SMILES for 4-aminooxolan-3-ol is NC1COCC1O.
What is the InChIKey of 4-aminooxolan-3-ol?
The InChIKey is HQVKXDYSIGDGSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO2/c5-3-1-7-2-4(3)6/h3-4,6H,1-2,5H2.
What are the key properties of 4-aminooxolan-3-ol?
4-aminooxolan-3-ol has a molecular weight of 103.12 g/mol, XLogP of -1.30, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminooxolan-3-ol is sourced from PubChem (CID 10486809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).