C4H10ClNO2 — CID 75531083
(3S,4S)-4-aminooxolan-3-ol;hydrochloride (PubChem CID 75531083) has the molecular formula C4H10ClNO2 and a molecular weight of 139.58 g/mol. Its IUPAC name is (3S,4S)-4-aminooxolan-3-ol;hydrochloride.
| Compound Name | (3S,4S)-4-aminooxolan-3-ol;hydrochloride |
|---|---|
| PubChem CID | 75531083 |
| Molecular Formula | C4H10ClNO2 |
| Molecular Weight | 139.58 g/mol |
| Exact Mass | 139.04 |
| IUPAC Name | (3S,4S)-4-aminooxolan-3-ol;hydrochloride |
| SMILES | Cl.N[C@H]1COC[C@H]1O |
| InChI | InChI=1S/C4H9NO2.ClH/c5-3-1-7-2-4(3)6;/h3-4,6H,1-2,5H2;1H/t3-,4+;/m0./s1 |
| InChIKey | XFDDJSOAVIFVIH-RFKZQXLXSA-N |
| XLogP | -0.87 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.58 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |