C9H17N5 — CID 104869459
(2R)-2-methyl-1-[(1-methyltriazol-4-yl)methyl]piperazine (PubChem CID 104869459) has the molecular formula C9H17N5 and a molecular weight of 195.27 g/mol. Its IUPAC name is (2R)-2-methyl-1-[(1-methyltriazol-4-yl)methyl]piperazine.
| Compound Name | (2R)-2-methyl-1-[(1-methyltriazol-4-yl)methyl]piperazine |
|---|---|
| PubChem CID | 104869459 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | (2R)-2-methyl-1-[(1-methyltriazol-4-yl)methyl]piperazine |
| SMILES | C[C@@H]1CNCCN1Cc1cn(C)nn1 |
| InChI | InChI=1S/C9H17N5/c1-8-5-10-3-4-14(8)7-9-6-13(2)12-11-9/h6,8,10H,3-5,7H2,1-2H3/t8-/m1/s1 |
| InChIKey | WZAIIMSAXJWFGJ-MRVPVSSYSA-N |
| XLogP | -0.39 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |