C10H16N6O — CID 107052736
2-[(1-methyltriazol-4-yl)methyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 107052736) has the molecular formula C10H16N6O and a molecular weight of 236.28 g/mol. Its IUPAC name is 2-[(1-methyltriazol-4-yl)methyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 2-[(1-methyltriazol-4-yl)methyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 107052736 |
| Molecular Formula | C10H16N6O |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 2-[(1-methyltriazol-4-yl)methyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | Cn1cc(CN2CC3CNCCN3C2=O)nn1 |
| InChI | InChI=1S/C10H16N6O/c1-14-5-8(12-13-14)6-15-7-9-4-11-2-3-16(9)10(15)17/h5,9,11H,2-4,6-7H2,1H3 |
| InChIKey | SSOHZJRBRJIQJG-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |