C11H17N5O — CID 82875976
2-[(1-methylpyrazol-3-yl)methyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 82875976) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is 2-[(1-methylpyrazol-3-yl)methyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 2-[(1-methylpyrazol-3-yl)methyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 82875976 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 2-[(1-methylpyrazol-3-yl)methyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | Cn1ccc(CN2CC3CNCCN3C2=O)n1 |
| InChI | InChI=1S/C11H17N5O/c1-14-4-2-9(13-14)7-15-8-10-6-12-3-5-16(10)11(15)17/h2,4,10,12H,3,5-8H2,1H3 |
| InChIKey | BOXCAXPIOVTBHT-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |