C8H16N2O2 — CID 104869516
(2S)-2-amino-N-(2-hydroxyethyl)-N-prop-2-enylpropanamide (PubChem CID 104869516) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is (2S)-2-amino-N-(2-hydroxyethyl)-N-prop-2-enylpropanamide.
| Compound Name | (2S)-2-amino-N-(2-hydroxyethyl)-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 104869516 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | (2S)-2-amino-N-(2-hydroxyethyl)-N-prop-2-enylpropanamide |
| SMILES | C=CCN(CCO)C(=O)[C@H](C)N |
| InChI | InChI=1S/C8H16N2O2/c1-3-4-10(5-6-11)8(12)7(2)9/h3,7,11H,1,4-6,9H2,2H3/t7-/m0/s1 |
| InChIKey | VCXBNOKIYPKYKL-ZETCQYMHSA-N |
| XLogP | -0.66 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|