C9H18N2O2 — CID 115633504
1-(2-hydroxyethyl)-3-propan-2-yl-1-prop-2-enylurea (PubChem CID 115633504) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-propan-2-yl-1-prop-2-enylurea.
| Compound Name | 1-(2-hydroxyethyl)-3-propan-2-yl-1-prop-2-enylurea |
|---|---|
| PubChem CID | 115633504 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-propan-2-yl-1-prop-2-enylurea |
| SMILES | C=CCN(CCO)C(=O)NC(C)C |
| InChI | InChI=1S/C9H18N2O2/c1-4-5-11(6-7-12)9(13)10-8(2)3/h4,8,12H,1,5-7H2,2-3H3,(H,10,13) |
| InChIKey | IQYTTZPSLHJLQC-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|