C15H28N2O2 — CID 111424305
1-(2-hydroxyethyl)-3-(2-propan-2-ylcyclohexyl)-1-prop-2-enylurea (PubChem CID 111424305) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-(2-propan-2-ylcyclohexyl)-1-prop-2-enylurea.
| Compound Name | 1-(2-hydroxyethyl)-3-(2-propan-2-ylcyclohexyl)-1-prop-2-enylurea |
|---|---|
| PubChem CID | 111424305 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-(2-propan-2-ylcyclohexyl)-1-prop-2-enylurea |
| SMILES | C=CCN(CCO)C(=O)NC1CCCCC1C(C)C |
| InChI | InChI=1S/C15H28N2O2/c1-4-9-17(10-11-18)15(19)16-14-8-6-5-7-13(14)12(2)3/h4,12-14,18H,1,5-11H2,2-3H3,(H,16,19) |
| InChIKey | CSPJCUWVCXCTNP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|