C11H15F3N2 — CID 104869635
N'-methyl-N'-[(2,4,5-trifluorophenyl)methyl]propane-1,3-diamine (PubChem CID 104869635) has the molecular formula C11H15F3N2 and a molecular weight of 232.25 g/mol. Its IUPAC name is N'-methyl-N'-[(2,4,5-trifluorophenyl)methyl]propane-1,3-diamine.
| Compound Name | N'-methyl-N'-[(2,4,5-trifluorophenyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 104869635 |
| Molecular Formula | C11H15F3N2 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | N'-methyl-N'-[(2,4,5-trifluorophenyl)methyl]propane-1,3-diamine |
| SMILES | CN(CCCN)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C11H15F3N2/c1-16(4-2-3-15)7-8-5-10(13)11(14)6-9(8)12/h5-6H,2-4,7,15H2,1H3 |
| InChIKey | CSTPMIRWZKCJOT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|