C8H17N3OS — CID 104870628
N'-hydroxy-2-(thian-3-ylamino)propanimidamide (PubChem CID 104870628) has the molecular formula C8H17N3OS and a molecular weight of 203.31 g/mol. Its IUPAC name is N'-hydroxy-2-(thian-3-ylamino)propanimidamide.
| Compound Name | N'-hydroxy-2-(thian-3-ylamino)propanimidamide |
|---|---|
| PubChem CID | 104870628 |
| Molecular Formula | C8H17N3OS |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | N'-hydroxy-2-(thian-3-ylamino)propanimidamide |
| SMILES | CC(NC1CCCSC1)C(N)=NO |
| InChI | InChI=1S/C8H17N3OS/c1-6(8(9)11-12)10-7-3-2-4-13-5-7/h6-7,10,12H,2-5H2,1H3,(H2,9,11) |
| InChIKey | DBLMLSZIKCBOIU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|