C10H13NO — CID 10487217
(4E,6E)-2-ethenyl-3-hydroxyocta-4,6-dienenitrile (PubChem CID 10487217) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is (4E,6E)-2-ethenyl-3-hydroxyocta-4,6-dienenitrile.
| Compound Name | (4E,6E)-2-ethenyl-3-hydroxyocta-4,6-dienenitrile |
|---|---|
| PubChem CID | 10487217 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (4E,6E)-2-ethenyl-3-hydroxyocta-4,6-dienenitrile |
| SMILES | C=CC(C#N)C(O)/C=C/C=C/C |
| InChI | InChI=1S/C10H13NO/c1-3-5-6-7-10(12)9(4-2)8-11/h3-7,9-10,12H,2H2,1H3/b5-3+,7-6+ |
| InChIKey | MZUZWWNWADLYOS-TWTPFVCWSA-N |
| XLogP | 1.81 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|