C10H17NO — CID 123308452
3-hydroxy-4,6-dimethyloct-4-enenitrile (PubChem CID 123308452) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 3-hydroxy-4,6-dimethyloct-4-enenitrile.
| Compound Name | 3-hydroxy-4,6-dimethyloct-4-enenitrile |
|---|---|
| PubChem CID | 123308452 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 3-hydroxy-4,6-dimethyloct-4-enenitrile |
| SMILES | CCC(C)C=C(C)C(O)CC#N |
| InChI | InChI=1S/C10H17NO/c1-4-8(2)7-9(3)10(12)5-6-11/h7-8,10,12H,4-5H2,1-3H3 |
| InChIKey | HCFYEPYPSHSKOZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|