C20H31NO — CID 134840471
(2Z,4E,8E,12E)-14-hydroxy-5,9,13-trimethyl-2-propan-2-yltetradeca-2,4,8,12-tetraenenitrile (PubChem CID 134840471) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is (2Z,4E,8E,12E)-14-hydroxy-5,9,13-trimethyl-2-propan-2-yltetradeca-2,4,8,12-tetraenenitrile.
| Compound Name | (2Z,4E,8E,12E)-14-hydroxy-5,9,13-trimethyl-2-propan-2-yltetradeca-2,4,8,12-tetraenenitrile |
|---|---|
| PubChem CID | 134840471 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | (2Z,4E,8E,12E)-14-hydroxy-5,9,13-trimethyl-2-propan-2-yltetradeca-2,4,8,12-tetraenenitrile |
| SMILES | C/C(=C\CC/C(C)=C/CC/C(C)=C/C=C(\C#N)C(C)C)CO |
| InChI | InChI=1S/C20H31NO/c1-16(2)20(14-21)13-12-18(4)10-6-8-17(3)9-7-11-19(5)15-22/h8,11-13,16,22H,6-7,9-10,15H2,1-5H3/b17-8+,18-12+,19-11+,20-13+ |
| InChIKey | UDWHZWNMLSZTOS-UIHRRHQOSA-N |
| XLogP | 5.48 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|