C15H23NO — CID 10944361
(2Z,4E)-8-hydroxy-5,9-dimethyl-2-propan-2-yldeca-2,4,9-trienenitrile (PubChem CID 10944361) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is (2Z,4E)-8-hydroxy-5,9-dimethyl-2-propan-2-yldeca-2,4,9-trienenitrile.
| Compound Name | (2Z,4E)-8-hydroxy-5,9-dimethyl-2-propan-2-yldeca-2,4,9-trienenitrile |
|---|---|
| PubChem CID | 10944361 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | (2Z,4E)-8-hydroxy-5,9-dimethyl-2-propan-2-yldeca-2,4,9-trienenitrile |
| SMILES | C=C(C)C(O)CC/C(C)=C/C=C(\C#N)C(C)C |
| InChI | InChI=1S/C15H23NO/c1-11(2)14(10-16)8-6-13(5)7-9-15(17)12(3)4/h6,8,11,15,17H,3,7,9H2,1-2,4-5H3/b13-6+,14-8+ |
| InChIKey | OMPMXURVOLKFDL-HKAZRAOBSA-N |
| XLogP | 3.76 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|