C17H27NO — CID 135009237
(4E)-12-hydroxy-5,9,13-trimethyltetradeca-4,8,13-trienenitrile (PubChem CID 135009237) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is (4E)-12-hydroxy-5,9,13-trimethyltetradeca-4,8,13-trienenitrile.
| Compound Name | (4E)-12-hydroxy-5,9,13-trimethyltetradeca-4,8,13-trienenitrile |
|---|---|
| PubChem CID | 135009237 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | (4E)-12-hydroxy-5,9,13-trimethyltetradeca-4,8,13-trienenitrile |
| SMILES | C=C(C)C(O)CCC(C)=CCC/C(C)=C/CCC#N |
| InChI | InChI=1S/C17H27NO/c1-14(2)17(19)12-11-16(4)10-7-9-15(3)8-5-6-13-18/h8,10,17,19H,1,5-7,9,11-12H2,2-4H3/b15-8+,16-10? |
| InChIKey | VRXAFHLXHQKHKM-CQXDTPHOSA-N |
| XLogP | 4.68 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|