C21H33NO — CID 135009281
(3E,7E)-15-hydroxy-4,8,12,16-tetramethylheptadeca-3,7,11,16-tetraenenitrile (PubChem CID 135009281) has the molecular formula C21H33NO and a molecular weight of 315.50 g/mol. Its IUPAC name is (3E,7E)-15-hydroxy-4,8,12,16-tetramethylheptadeca-3,7,11,16-tetraenenitrile.
| Compound Name | (3E,7E)-15-hydroxy-4,8,12,16-tetramethylheptadeca-3,7,11,16-tetraenenitrile |
|---|---|
| PubChem CID | 135009281 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | (3E,7E)-15-hydroxy-4,8,12,16-tetramethylheptadeca-3,7,11,16-tetraenenitrile |
| SMILES | C=C(C)C(O)CCC(C)=CCC/C(C)=C/CC/C(C)=C/CC#N |
| InChI | InChI=1S/C21H33NO/c1-17(2)21(23)15-14-20(5)12-7-10-18(3)9-6-11-19(4)13-8-16-22/h9,12-13,21,23H,1,6-8,10-11,14-15H2,2-5H3/b18-9+,19-13+,20-12? |
| InChIKey | LLQWCDGYKCXMMY-HZAJNSBNSA-N |
| XLogP | 6.02 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|