C13H21NO — CID 135046800
(5E)-2-hydroxy-6,10-dimethylundeca-5,9-dienenitrile (PubChem CID 135046800) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (5E)-2-hydroxy-6,10-dimethylundeca-5,9-dienenitrile.
| Compound Name | (5E)-2-hydroxy-6,10-dimethylundeca-5,9-dienenitrile |
|---|---|
| PubChem CID | 135046800 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (5E)-2-hydroxy-6,10-dimethylundeca-5,9-dienenitrile |
| SMILES | CC(C)=CCC/C(C)=C/CCC(O)C#N |
| InChI | InChI=1S/C13H21NO/c1-11(2)6-4-7-12(3)8-5-9-13(15)10-14/h6,8,13,15H,4-5,7,9H2,1-3H3/b12-8+ |
| InChIKey | YLPRDCFYXQUAIB-XYOKQWHBSA-N |
| XLogP | 3.34 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|