C14H23NO — CID 135046799
(5E)-2-hydroxy-2,6,10-trimethylundeca-5,9-dienenitrile (PubChem CID 135046799) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is (5E)-2-hydroxy-2,6,10-trimethylundeca-5,9-dienenitrile.
| Compound Name | (5E)-2-hydroxy-2,6,10-trimethylundeca-5,9-dienenitrile |
|---|---|
| PubChem CID | 135046799 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | (5E)-2-hydroxy-2,6,10-trimethylundeca-5,9-dienenitrile |
| SMILES | CC(C)=CCC/C(C)=C/CCC(C)(O)C#N |
| InChI | InChI=1S/C14H23NO/c1-12(2)7-5-8-13(3)9-6-10-14(4,16)11-15/h7,9,16H,5-6,8,10H2,1-4H3/b13-9+ |
| InChIKey | CHAZQAKKYMHKKF-UKTHLTGXSA-N |
| XLogP | 3.73 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|