About 2-amino-4-methyl-N-(2-propylcyclopropyl)-1,3-thiazole-5-carboxamide
2-amino-4-methyl-N-(2-propylcyclopropyl)-1,3-thiazole-5-carboxamide (PubChem CID 104872552) has the molecular formula C11H17N3OS
and a molecular weight of 239.34 g/mol. Its IUPAC name is 2-amino-4-methyl-N-(2-propylcyclopropyl)-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-amino-4-methyl-N-(2-propylcyclopropyl)-1,3-thiazole-5-carboxamide |
| PubChem CID | 104872552 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2-amino-4-methyl-N-(2-propylcyclopropyl)-1,3-thiazole-5-carboxamide |
| SMILES | CCCC1CC1NC(=O)c1sc(N)nc1C |
| InChI | InChI=1S/C11H17N3OS/c1-3-4-7-5-8(7)14-10(15)9-6(2)13-11(12)16-9/h7-8H,3-5H2,1-2H3,(H2,12,13)(H,14,15) |
| InChIKey | GQCGESQPPVUHCM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-4-methyl-N-(2-propylcyclopropyl)-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-methyl-N-(2-propylcyclopropyl)-1,3-thiazole-5-carboxamide?
The IUPAC name of 2-amino-4-methyl-N-(2-propylcyclopropyl)-1,3-thiazole-5-carboxamide (CID 104872552) is 2-amino-4-methyl-N-(2-propylcyclopropyl)-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 2-amino-4-methyl-N-(2-propylcyclopropyl)-1,3-thiazole-5-carboxamide?
The canonical SMILES for 2-amino-4-methyl-N-(2-propylcyclopropyl)-1,3-thiazole-5-carboxamide is CCCC1CC1NC(=O)c1sc(N)nc1C.
What is the InChIKey of 2-amino-4-methyl-N-(2-propylcyclopropyl)-1,3-thiazole-5-carboxamide?
The InChIKey is GQCGESQPPVUHCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3OS/c1-3-4-7-5-8(7)14-10(15)9-6(2)13-11(12)16-9/h7-8H,3-5H2,1-2H3,(H2,12,13)(H,14,15).
What are the key properties of 2-amino-4-methyl-N-(2-propylcyclopropyl)-1,3-thiazole-5-carboxamide?
2-amino-4-methyl-N-(2-propylcyclopropyl)-1,3-thiazole-5-carboxamide has a molecular weight of 239.34 g/mol, XLogP of 1.95, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-methyl-N-(2-propylcyclopropyl)-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 104872552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).