C8H12O4 — CID 10487392
methyl (3R,5S)-3,5-dihydroxycyclohexene-1-carboxylate (PubChem CID 10487392) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is methyl (3R,5S)-3,5-dihydroxycyclohexene-1-carboxylate.
| Compound Name | methyl (3R,5S)-3,5-dihydroxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 10487392 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | methyl (3R,5S)-3,5-dihydroxycyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=C[C@H](O)C[C@@H](O)C1 |
| InChI | InChI=1S/C8H12O4/c1-12-8(11)5-2-6(9)4-7(10)3-5/h2,6-7,9-10H,3-4H2,1H3/t6-,7-/m0/s1 |
| InChIKey | FEFNGZXKDZBHPZ-BQBZGAKWSA-N |
| XLogP | -0.40 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |