C11H20N2O5 — CID 104874054
(2R)-2-(2-ethylbutylcarbamoylamino)butanedioic acid (PubChem CID 104874054) has the molecular formula C11H20N2O5 and a molecular weight of 260.29 g/mol. Its IUPAC name is (2R)-2-(2-ethylbutylcarbamoylamino)butanedioic acid.
| Compound Name | (2R)-2-(2-ethylbutylcarbamoylamino)butanedioic acid |
|---|---|
| PubChem CID | 104874054 |
| Molecular Formula | C11H20N2O5 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (2R)-2-(2-ethylbutylcarbamoylamino)butanedioic acid |
| SMILES | CCC(CC)CNC(=O)N[C@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H20N2O5/c1-3-7(4-2)6-12-11(18)13-8(10(16)17)5-9(14)15/h7-8H,3-6H2,1-2H3,(H,14,15)(H,16,17)(H2,12,13,18)/t8-/m1/s1 |
| InChIKey | HGIPKBLCWXMQGM-MRVPVSSYSA-N |
| XLogP | 0.65 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |