C7H17N3OS — CID 104876660
2-hydroxy-1-methyl-1-(4-methylsulfanylbutan-2-yl)guanidine (PubChem CID 104876660) has the molecular formula C7H17N3OS and a molecular weight of 191.30 g/mol. Its IUPAC name is 2-hydroxy-1-methyl-1-(4-methylsulfanylbutan-2-yl)guanidine.
| Compound Name | 2-hydroxy-1-methyl-1-(4-methylsulfanylbutan-2-yl)guanidine |
|---|---|
| PubChem CID | 104876660 |
| Molecular Formula | C7H17N3OS |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2-hydroxy-1-methyl-1-(4-methylsulfanylbutan-2-yl)guanidine |
| SMILES | CSCCC(C)N(C)C(N)=NO |
| InChI | InChI=1S/C7H17N3OS/c1-6(4-5-12-3)10(2)7(8)9-11/h6,11H,4-5H2,1-3H3,(H2,8,9) |
| InChIKey | HTDLKIUNCZABLO-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|