C10H22N2OS — CID 115640922
1-methyl-1-(4-methylsulfanylbutan-2-yl)-3-propylurea (PubChem CID 115640922) has the molecular formula C10H22N2OS and a molecular weight of 218.37 g/mol. Its IUPAC name is 1-methyl-1-(4-methylsulfanylbutan-2-yl)-3-propylurea.
| Compound Name | 1-methyl-1-(4-methylsulfanylbutan-2-yl)-3-propylurea |
|---|---|
| PubChem CID | 115640922 |
| Molecular Formula | C10H22N2OS |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 1-methyl-1-(4-methylsulfanylbutan-2-yl)-3-propylurea |
| SMILES | CCCNC(=O)N(C)C(C)CCSC |
| InChI | InChI=1S/C10H22N2OS/c1-5-7-11-10(13)12(3)9(2)6-8-14-4/h9H,5-8H2,1-4H3,(H,11,13) |
| InChIKey | KZBBGCVPASGZLP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |