C9H17N3O — CID 63224450
1-(1-cyanopropan-2-yl)-1-methyl-3-propylurea (PubChem CID 63224450) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is 1-(1-cyanopropan-2-yl)-1-methyl-3-propylurea.
| Compound Name | 1-(1-cyanopropan-2-yl)-1-methyl-3-propylurea |
|---|---|
| PubChem CID | 63224450 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 1-(1-cyanopropan-2-yl)-1-methyl-3-propylurea |
| SMILES | CCCNC(=O)N(C)C(C)CC#N |
| InChI | InChI=1S/C9H17N3O/c1-4-7-11-9(13)12(3)8(2)5-6-10/h8H,4-5,7H2,1-3H3,(H,11,13) |
| InChIKey | WZDVHIUYRBTYLC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |