C12H21N3O3 — CID 82013488
5-[[1-cyanopropan-2-yl(methyl)carbamoyl]amino]-4-methylpentanoic acid (PubChem CID 82013488) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is 5-[[1-cyanopropan-2-yl(methyl)carbamoyl]amino]-4-methylpentanoic acid.
| Compound Name | 5-[[1-cyanopropan-2-yl(methyl)carbamoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 82013488 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 5-[[1-cyanopropan-2-yl(methyl)carbamoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(CCC(=O)O)CNC(=O)N(C)C(C)CC#N |
| InChI | InChI=1S/C12H21N3O3/c1-9(4-5-11(16)17)8-14-12(18)15(3)10(2)6-7-13/h9-10H,4-6,8H2,1-3H3,(H,14,18)(H,16,17) |
| InChIKey | UOAFIJDVORPMJU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |