About 4-[[1-cyanopropan-2-yl(methyl)carbamoyl]amino]-2,2-dimethyl-4-oxobutanoic acid
4-[[1-cyanopropan-2-yl(methyl)carbamoyl]amino]-2,2-dimethyl-4-oxobutanoic acid (PubChem CID 65301403) has the molecular formula C12H19N3O4
and a molecular weight of 269.30 g/mol. Its IUPAC name is 4-[[1-cyanopropan-2-yl(methyl)carbamoyl]amino]-2,2-dimethyl-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-[[1-cyanopropan-2-yl(methyl)carbamoyl]amino]-2,2-dimethyl-4-oxobutanoic acid |
| PubChem CID | 65301403 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 4-[[1-cyanopropan-2-yl(methyl)carbamoyl]amino]-2,2-dimethyl-4-oxobutanoic acid |
| SMILES | CC(CC#N)N(C)C(=O)NC(=O)CC(C)(C)C(=O)O |
| InChI | InChI=1S/C12H19N3O4/c1-8(5-6-13)15(4)11(19)14-9(16)7-12(2,3)10(17)18/h8H,5,7H2,1-4H3,(H,17,18)(H,14,16,19) |
| InChIKey | SJDWRUPVQBVELE-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[1-cyanopropan-2-yl(methyl)carbamoyl]amino]-2,2-dimethyl-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[1-cyanopropan-2-yl(methyl)carbamoyl]amino]-2,2-dimethyl-4-oxobutanoic acid?
The IUPAC name of 4-[[1-cyanopropan-2-yl(methyl)carbamoyl]amino]-2,2-dimethyl-4-oxobutanoic acid (CID 65301403) is 4-[[1-cyanopropan-2-yl(methyl)carbamoyl]amino]-2,2-dimethyl-4-oxobutanoic acid.
What is the SMILES notation for 4-[[1-cyanopropan-2-yl(methyl)carbamoyl]amino]-2,2-dimethyl-4-oxobutanoic acid?
The canonical SMILES for 4-[[1-cyanopropan-2-yl(methyl)carbamoyl]amino]-2,2-dimethyl-4-oxobutanoic acid is CC(CC#N)N(C)C(=O)NC(=O)CC(C)(C)C(=O)O.
What is the InChIKey of 4-[[1-cyanopropan-2-yl(methyl)carbamoyl]amino]-2,2-dimethyl-4-oxobutanoic acid?
The InChIKey is SJDWRUPVQBVELE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O4/c1-8(5-6-13)15(4)11(19)14-9(16)7-12(2,3)10(17)18/h8H,5,7H2,1-4H3,(H,17,18)(H,14,16,19).
What are the key properties of 4-[[1-cyanopropan-2-yl(methyl)carbamoyl]amino]-2,2-dimethyl-4-oxobutanoic acid?
4-[[1-cyanopropan-2-yl(methyl)carbamoyl]amino]-2,2-dimethyl-4-oxobutanoic acid has a molecular weight of 269.30 g/mol, XLogP of 0.96, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1-cyanopropan-2-yl(methyl)carbamoyl]amino]-2,2-dimethyl-4-oxobutanoic acid is sourced from PubChem (CID 65301403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).