C14H20FNO3 — CID 104877449
(1R)-1-[5-fluoro-2-[3-(hydroxymethyl)morpholin-4-yl]-4-methylphenyl]ethanol (PubChem CID 104877449) has the molecular formula C14H20FNO3 and a molecular weight of 269.32 g/mol. Its IUPAC name is (1R)-1-[5-fluoro-2-[3-(hydroxymethyl)morpholin-4-yl]-4-methylphenyl]ethanol.
| Compound Name | (1R)-1-[5-fluoro-2-[3-(hydroxymethyl)morpholin-4-yl]-4-methylphenyl]ethanol |
|---|---|
| PubChem CID | 104877449 |
| Molecular Formula | C14H20FNO3 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (1R)-1-[5-fluoro-2-[3-(hydroxymethyl)morpholin-4-yl]-4-methylphenyl]ethanol |
| SMILES | Cc1cc(N2CCOCC2CO)c([C@@H](C)O)cc1F |
| InChI | InChI=1S/C14H20FNO3/c1-9-5-14(12(10(2)18)6-13(9)15)16-3-4-19-8-11(16)7-17/h5-6,10-11,17-18H,3-4,7-8H2,1-2H3/t10-,11?/m1/s1 |
| InChIKey | CMCXWEXWYHYWKS-NFJWQWPMSA-N |
| XLogP | 1.38 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |