C9H21N5O — CID 104881892
N'-amino-4-(2-hydroxy-2-methylpropyl)piperazine-1-carboximidamide (PubChem CID 104881892) has the molecular formula C9H21N5O and a molecular weight of 215.30 g/mol. Its IUPAC name is N'-amino-4-(2-hydroxy-2-methylpropyl)piperazine-1-carboximidamide.
| Compound Name | N'-amino-4-(2-hydroxy-2-methylpropyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 104881892 |
| Molecular Formula | C9H21N5O |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | N'-amino-4-(2-hydroxy-2-methylpropyl)piperazine-1-carboximidamide |
| SMILES | CC(C)(O)CN1CCN(C(N)=NN)CC1 |
| InChI | InChI=1S/C9H21N5O/c1-9(2,15)7-13-3-5-14(6-4-13)8(10)12-11/h15H,3-7,11H2,1-2H3,(H2,10,12) |
| InChIKey | UCIMVCWNVXSSOM-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 91.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|