C14H28N4O3 — CID 77033006
N'-hydroxy-2-[4-(2-hydroxy-2-methylpropyl)piperazine-1-carbonyl]-3-methylbutanimidamide (PubChem CID 77033006) has the molecular formula C14H28N4O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is N'-hydroxy-2-[4-(2-hydroxy-2-methylpropyl)piperazine-1-carbonyl]-3-methylbutanimidamide.
| Compound Name | N'-hydroxy-2-[4-(2-hydroxy-2-methylpropyl)piperazine-1-carbonyl]-3-methylbutanimidamide |
|---|---|
| PubChem CID | 77033006 |
| Molecular Formula | C14H28N4O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | N'-hydroxy-2-[4-(2-hydroxy-2-methylpropyl)piperazine-1-carbonyl]-3-methylbutanimidamide |
| SMILES | CC(C)C(C(=O)N1CCN(CC(C)(C)O)CC1)C(N)=NO |
| InChI | InChI=1S/C14H28N4O3/c1-10(2)11(12(15)16-21)13(19)18-7-5-17(6-8-18)9-14(3,4)20/h10-11,20-21H,5-9H2,1-4H3,(H2,15,16) |
| InChIKey | GSLNAUQYOVQEEW-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|