C8H19N5O — CID 104881894
N'-amino-2-[(dimethylamino)methyl]-4-hydroxypyrrolidine-1-carboximidamide (PubChem CID 104881894) has the molecular formula C8H19N5O and a molecular weight of 201.27 g/mol. Its IUPAC name is N'-amino-2-[(dimethylamino)methyl]-4-hydroxypyrrolidine-1-carboximidamide.
| Compound Name | N'-amino-2-[(dimethylamino)methyl]-4-hydroxypyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 104881894 |
| Molecular Formula | C8H19N5O |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | N'-amino-2-[(dimethylamino)methyl]-4-hydroxypyrrolidine-1-carboximidamide |
| SMILES | CN(C)CC1CC(O)CN1C(N)=NN |
| InChI | InChI=1S/C8H19N5O/c1-12(2)4-6-3-7(14)5-13(6)8(9)11-10/h6-7,14H,3-5,10H2,1-2H3,(H2,9,11) |
| InChIKey | IXGRYCIUYVOSFX-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 91.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|