C7H16N4O — CID 104881959
N-amino-N',2-dimethylmorpholine-4-carboximidamide (PubChem CID 104881959) has the molecular formula C7H16N4O and a molecular weight of 172.23 g/mol. Its IUPAC name is N-amino-N',2-dimethylmorpholine-4-carboximidamide.
| Compound Name | N-amino-N',2-dimethylmorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 104881959 |
| Molecular Formula | C7H16N4O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | N-amino-N',2-dimethylmorpholine-4-carboximidamide |
| SMILES | C/N=C(\NN)N1CCOC(C)C1 |
| InChI | InChI=1S/C7H16N4O/c1-6-5-11(3-4-12-6)7(9-2)10-8/h6H,3-5,8H2,1-2H3,(H,9,10) |
| InChIKey | NXVPYGSYHHGRNE-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|