C12H22O2 — CID 10488196
(E,1S)-1-[(2R,3S)-3-methyloxiran-2-yl]non-2-en-1-ol (PubChem CID 10488196) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (E,1S)-1-[(2R,3S)-3-methyloxiran-2-yl]non-2-en-1-ol.
| Compound Name | (E,1S)-1-[(2R,3S)-3-methyloxiran-2-yl]non-2-en-1-ol |
|---|---|
| PubChem CID | 10488196 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (E,1S)-1-[(2R,3S)-3-methyloxiran-2-yl]non-2-en-1-ol |
| SMILES | CCCCCC/C=C/[C@H](O)[C@H]1O[C@H]1C |
| InChI | InChI=1S/C12H22O2/c1-3-4-5-6-7-8-9-11(13)12-10(2)14-12/h8-13H,3-7H2,1-2H3/b9-8+/t10-,11-,12-/m0/s1 |
| InChIKey | KREDRDJKWOISHK-WCEKOLQBSA-N |
| XLogP | 2.66 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|