C8H20N4 — CID 104882019
3-amino-1,2-dimethyl-1-(3-methylbutan-2-yl)guanidine (PubChem CID 104882019) has the molecular formula C8H20N4 and a molecular weight of 172.28 g/mol. Its IUPAC name is 3-amino-1,2-dimethyl-1-(3-methylbutan-2-yl)guanidine.
| Compound Name | 3-amino-1,2-dimethyl-1-(3-methylbutan-2-yl)guanidine |
|---|---|
| PubChem CID | 104882019 |
| Molecular Formula | C8H20N4 |
| Molecular Weight | 172.28 g/mol |
| Exact Mass | 172.17 |
| IUPAC Name | 3-amino-1,2-dimethyl-1-(3-methylbutan-2-yl)guanidine |
| SMILES | C/N=C(\NN)N(C)C(C)C(C)C |
| InChI | InChI=1S/C8H20N4/c1-6(2)7(3)12(5)8(10-4)11-9/h6-7H,9H2,1-5H3,(H,10,11) |
| InChIKey | VACJEQWJAQLQRA-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.28 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|