C10H22N4 — CID 104882039
N-amino-N'-methyl-4-propylpiperidine-1-carboximidamide (PubChem CID 104882039) has the molecular formula C10H22N4 and a molecular weight of 198.31 g/mol. Its IUPAC name is N-amino-N'-methyl-4-propylpiperidine-1-carboximidamide.
| Compound Name | N-amino-N'-methyl-4-propylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 104882039 |
| Molecular Formula | C10H22N4 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | N-amino-N'-methyl-4-propylpiperidine-1-carboximidamide |
| SMILES | CCCC1CCN(/C(=N/C)NN)CC1 |
| InChI | InChI=1S/C10H22N4/c1-3-4-9-5-7-14(8-6-9)10(12-2)13-11/h9H,3-8,11H2,1-2H3,(H,12,13) |
| InChIKey | VAXUMENVSFKFJX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|