C11H21F3N4 — CID 104887101
N-amino-N'-(2-methylpropyl)-4-(trifluoromethyl)piperidine-1-carboximidamide (PubChem CID 104887101) has the molecular formula C11H21F3N4 and a molecular weight of 266.31 g/mol. Its IUPAC name is N-amino-N'-(2-methylpropyl)-4-(trifluoromethyl)piperidine-1-carboximidamide.
| Compound Name | N-amino-N'-(2-methylpropyl)-4-(trifluoromethyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 104887101 |
| Molecular Formula | C11H21F3N4 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | N-amino-N'-(2-methylpropyl)-4-(trifluoromethyl)piperidine-1-carboximidamide |
| SMILES | CC(C)C/N=C(\NN)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H21F3N4/c1-8(2)7-16-10(17-15)18-5-3-9(4-6-18)11(12,13)14/h8-9H,3-7,15H2,1-2H3,(H,16,17) |
| InChIKey | MMLMXBMOIVNKKQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|