C7H18N4O — CID 104882093
1-amino-3-(1-ethoxypropan-2-yl)-2-methylguanidine (PubChem CID 104882093) has the molecular formula C7H18N4O and a molecular weight of 174.25 g/mol. Its IUPAC name is 1-amino-3-(1-ethoxypropan-2-yl)-2-methylguanidine.
| Compound Name | 1-amino-3-(1-ethoxypropan-2-yl)-2-methylguanidine |
|---|---|
| PubChem CID | 104882093 |
| Molecular Formula | C7H18N4O |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.15 |
| IUPAC Name | 1-amino-3-(1-ethoxypropan-2-yl)-2-methylguanidine |
| SMILES | CCOCC(C)N/C(=N/C)NN |
| InChI | InChI=1S/C7H18N4O/c1-4-12-5-6(2)10-7(9-3)11-8/h6H,4-5,8H2,1-3H3,(H2,9,10,11) |
| InChIKey | SNVOTHQXFYGJJO-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|