C9H22N4 — CID 104882147
3-amino-1,2-dimethyl-1-(4-methylpentan-2-yl)guanidine (PubChem CID 104882147) has the molecular formula C9H22N4 and a molecular weight of 186.30 g/mol. Its IUPAC name is 3-amino-1,2-dimethyl-1-(4-methylpentan-2-yl)guanidine.
| Compound Name | 3-amino-1,2-dimethyl-1-(4-methylpentan-2-yl)guanidine |
|---|---|
| PubChem CID | 104882147 |
| Molecular Formula | C9H22N4 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.18 |
| IUPAC Name | 3-amino-1,2-dimethyl-1-(4-methylpentan-2-yl)guanidine |
| SMILES | C/N=C(\NN)N(C)C(C)CC(C)C |
| InChI | InChI=1S/C9H22N4/c1-7(2)6-8(3)13(5)9(11-4)12-10/h7-8H,6,10H2,1-5H3,(H,11,12) |
| InChIKey | CLCXYCOCAVRFDE-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|