C10H24N4O — CID 104882157
3-amino-1-(2-methoxyethyl)-2-methyl-1-pentan-3-ylguanidine (PubChem CID 104882157) has the molecular formula C10H24N4O and a molecular weight of 216.33 g/mol. Its IUPAC name is 3-amino-1-(2-methoxyethyl)-2-methyl-1-pentan-3-ylguanidine.
| Compound Name | 3-amino-1-(2-methoxyethyl)-2-methyl-1-pentan-3-ylguanidine |
|---|---|
| PubChem CID | 104882157 |
| Molecular Formula | C10H24N4O |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.20 |
| IUPAC Name | 3-amino-1-(2-methoxyethyl)-2-methyl-1-pentan-3-ylguanidine |
| SMILES | CCC(CC)N(CCOC)/C(=N/C)NN |
| InChI | InChI=1S/C10H24N4O/c1-5-9(6-2)14(7-8-15-4)10(12-3)13-11/h9H,5-8,11H2,1-4H3,(H,12,13) |
| InChIKey | TZAATCNYWKOEFJ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|