C9H21N5 — CID 104882350
3-amino-1,2-dimethyl-1-[(1-methylpyrrolidin-2-yl)methyl]guanidine (PubChem CID 104882350) has the molecular formula C9H21N5 and a molecular weight of 199.30 g/mol. Its IUPAC name is 3-amino-1,2-dimethyl-1-[(1-methylpyrrolidin-2-yl)methyl]guanidine.
| Compound Name | 3-amino-1,2-dimethyl-1-[(1-methylpyrrolidin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 104882350 |
| Molecular Formula | C9H21N5 |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.18 |
| IUPAC Name | 3-amino-1,2-dimethyl-1-[(1-methylpyrrolidin-2-yl)methyl]guanidine |
| SMILES | C/N=C(\NN)N(C)CC1CCCN1C |
| InChI | InChI=1S/C9H21N5/c1-11-9(12-10)14(3)7-8-5-4-6-13(8)2/h8H,4-7,10H2,1-3H3,(H,11,12) |
| InChIKey | CMLQMSDBVVDLMU-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|