C13H29N5O — CID 104882593
N-amino-2-[(dimethylamino)methyl]-N'-(3-ethoxypropyl)pyrrolidine-1-carboximidamide (PubChem CID 104882593) has the molecular formula C13H29N5O and a molecular weight of 271.41 g/mol. Its IUPAC name is N-amino-2-[(dimethylamino)methyl]-N'-(3-ethoxypropyl)pyrrolidine-1-carboximidamide.
| Compound Name | N-amino-2-[(dimethylamino)methyl]-N'-(3-ethoxypropyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 104882593 |
| Molecular Formula | C13H29N5O |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.24 |
| IUPAC Name | N-amino-2-[(dimethylamino)methyl]-N'-(3-ethoxypropyl)pyrrolidine-1-carboximidamide |
| SMILES | CCOCCC/N=C(\NN)N1CCCC1CN(C)C |
| InChI | InChI=1S/C13H29N5O/c1-4-19-10-6-8-15-13(16-14)18-9-5-7-12(18)11-17(2)3/h12H,4-11,14H2,1-3H3,(H,15,16) |
| InChIKey | SVEGOHXGVJNQIO-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|