C12H29N5 — CID 104883067
1-amino-3-[3-(diethylamino)propyl]-2-(2-methylpropyl)guanidine (PubChem CID 104883067) has the molecular formula C12H29N5 and a molecular weight of 243.40 g/mol. Its IUPAC name is 1-amino-3-[3-(diethylamino)propyl]-2-(2-methylpropyl)guanidine.
| Compound Name | 1-amino-3-[3-(diethylamino)propyl]-2-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 104883067 |
| Molecular Formula | C12H29N5 |
| Molecular Weight | 243.40 g/mol |
| Exact Mass | 243.24 |
| IUPAC Name | 1-amino-3-[3-(diethylamino)propyl]-2-(2-methylpropyl)guanidine |
| SMILES | CCN(CC)CCCN/C(=N\CC(C)C)NN |
| InChI | InChI=1S/C12H29N5/c1-5-17(6-2)9-7-8-14-12(16-13)15-10-11(3)4/h11H,5-10,13H2,1-4H3,(H2,14,15,16) |
| InChIKey | XAEWGTPTABIUEX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.40 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|