C11H23N5O — CID 104888724
N-[2-[[N-amino-N'-(2-methylpropyl)carbamimidoyl]amino]ethyl]cyclopropanecarboxamide (PubChem CID 104888724) has the molecular formula C11H23N5O and a molecular weight of 241.34 g/mol. Its IUPAC name is N-[2-[[N-amino-N'-(2-methylpropyl)carbamimidoyl]amino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[[N-amino-N'-(2-methylpropyl)carbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 104888724 |
| Molecular Formula | C11H23N5O |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | N-[2-[[N-amino-N'-(2-methylpropyl)carbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
| SMILES | CC(C)C/N=C(\NN)NCCNC(=O)C1CC1 |
| InChI | InChI=1S/C11H23N5O/c1-8(2)7-15-11(16-12)14-6-5-13-10(17)9-3-4-9/h8-9H,3-7,12H2,1-2H3,(H,13,17)(H2,14,15,16) |
| InChIKey | ZUJDYFDREBNGJO-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|