C14H29N5 — CID 104883116
1-amino-3-cyclohexyl-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine (PubChem CID 104883116) has the molecular formula C14H29N5 and a molecular weight of 267.42 g/mol. Its IUPAC name is 1-amino-3-cyclohexyl-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine.
| Compound Name | 1-amino-3-cyclohexyl-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 104883116 |
| Molecular Formula | C14H29N5 |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.24 |
| IUPAC Name | 1-amino-3-cyclohexyl-2-[(1-ethylpyrrolidin-2-yl)methyl]guanidine |
| SMILES | CCN1CCCC1C/N=C(\NN)NC1CCCCC1 |
| InChI | InChI=1S/C14H29N5/c1-2-19-10-6-9-13(19)11-16-14(18-15)17-12-7-4-3-5-8-12/h12-13H,2-11,15H2,1H3,(H2,16,17,18) |
| InChIKey | JBIWXQJZZRQVIJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|