About N-amino-N'-butylthiomorpholine-4-carboximidamide
N-amino-N'-butylthiomorpholine-4-carboximidamide (PubChem CID 104883431) has the molecular formula C9H20N4S
and a molecular weight of 216.35 g/mol. Its IUPAC name is N-amino-N'-butylthiomorpholine-4-carboximidamide.
Molecular Properties
| Compound Name | N-amino-N'-butylthiomorpholine-4-carboximidamide |
| PubChem CID | 104883431 |
| Molecular Formula | C9H20N4S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | N-amino-N'-butylthiomorpholine-4-carboximidamide |
| SMILES | CCCC/N=C(\NN)N1CCSCC1 |
| InChI | InChI=1S/C9H20N4S/c1-2-3-4-11-9(12-10)13-5-7-14-8-6-13/h2-8,10H2,1H3,(H,11,12) |
| InChIKey | VVUVQAGQLQYCAW-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-amino-N'-butylthiomorpholine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-N'-butylthiomorpholine-4-carboximidamide?
The IUPAC name of N-amino-N'-butylthiomorpholine-4-carboximidamide (CID 104883431) is N-amino-N'-butylthiomorpholine-4-carboximidamide.
What is the SMILES notation for N-amino-N'-butylthiomorpholine-4-carboximidamide?
The canonical SMILES for N-amino-N'-butylthiomorpholine-4-carboximidamide is CCCC/N=C(\NN)N1CCSCC1.
What is the InChIKey of N-amino-N'-butylthiomorpholine-4-carboximidamide?
The InChIKey is VVUVQAGQLQYCAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N4S/c1-2-3-4-11-9(12-10)13-5-7-14-8-6-13/h2-8,10H2,1H3,(H,11,12).
What are the key properties of N-amino-N'-butylthiomorpholine-4-carboximidamide?
N-amino-N'-butylthiomorpholine-4-carboximidamide has a molecular weight of 216.35 g/mol, XLogP of 0.65, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-N'-butylthiomorpholine-4-carboximidamide is sourced from PubChem (CID 104883431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).