C11H25N5O — CID 104883732
1-amino-2-(3-methoxypropyl)-3-(1-methylpiperidin-4-yl)guanidine (PubChem CID 104883732) has the molecular formula C11H25N5O and a molecular weight of 243.35 g/mol. Its IUPAC name is 1-amino-2-(3-methoxypropyl)-3-(1-methylpiperidin-4-yl)guanidine.
| Compound Name | 1-amino-2-(3-methoxypropyl)-3-(1-methylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 104883732 |
| Molecular Formula | C11H25N5O |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.21 |
| IUPAC Name | 1-amino-2-(3-methoxypropyl)-3-(1-methylpiperidin-4-yl)guanidine |
| SMILES | COCCC/N=C(\NN)NC1CCN(C)CC1 |
| InChI | InChI=1S/C11H25N5O/c1-16-7-4-10(5-8-16)14-11(15-12)13-6-3-9-17-2/h10H,3-9,12H2,1-2H3,(H2,13,14,15) |
| InChIKey | FNWGBGQDHDFBBY-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|